C15H11ClF3N5OS — CID 2314132
N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide (PubChem CID 2314132) has the molecular formula C15H11ClF3N5OS and a molecular weight of 401.80 g/mol. Its IUPAC name is N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide.
| Compound Name | N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide |
|---|---|
| PubChem CID | 2314132 |
| Molecular Formula | C15H11ClF3N5OS |
| Molecular Weight | 401.80 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | N-[(6-chloroimidazo[2,1-b][1,3]thiazol-5-yl)methylideneamino]-2-[3-(trifluoromethyl)anilino]acetamide |
| SMILES | O=C(CNc1cccc(C(F)(F)F)c1)NN=Cc1c(Cl)nc2sccn12 |
| InChI | InChI=1S/C15H11ClF3N5OS/c16-13-11(24-4-5-26-14(24)22-13)7-21-23-12(25)8-20-10-3-1-2-9(6-10)15(17,18)19/h1-7,20H,8H2,(H,23,25) |
| InChIKey | NYAQJZIAOJXMGO-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 70.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.80 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|