C23H18BrN3O — CID 3714888
6-bromo-N-[(4-methoxyphenyl)methylideneamino]-4-phenylquinolin-2-amine (PubChem CID 3714888) has the molecular formula C23H18BrN3O and a molecular weight of 432.32 g/mol. Its IUPAC name is 6-bromo-N-[(4-methoxyphenyl)methylideneamino]-4-phenylquinolin-2-amine.
| Compound Name | 6-bromo-N-[(4-methoxyphenyl)methylideneamino]-4-phenylquinolin-2-amine |
|---|---|
| PubChem CID | 3714888 |
| Molecular Formula | C23H18BrN3O |
| Molecular Weight | 432.32 g/mol |
| Exact Mass | 431.06 |
| IUPAC Name | 6-bromo-N-[(4-methoxyphenyl)methylideneamino]-4-phenylquinolin-2-amine |
| SMILES | COc1ccc(C=NNc2cc(-c3ccccc3)c3cc(Br)ccc3n2)cc1 |
| InChI | InChI=1S/C23H18BrN3O/c1-28-19-10-7-16(8-11-19)15-25-27-23-14-20(17-5-3-2-4-6-17)21-13-18(24)9-12-22(21)26-23/h2-15H,1H3,(H,26,27) |
| InChIKey | ZTVRELBHROLSIO-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 46.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.32 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|