C25H21BrN6O — CID 10673027
10-bromo-N-[(E)-(4-methoxyphenyl)methylideneamino]-6-methyl-4-phenyl-[1,2,4]triazino[2,3-c]quinazolin-3-amine (PubChem CID 10673027) has the molecular formula C25H21BrN6O and a molecular weight of 501.39 g/mol. Its IUPAC name is 10-bromo-N-[(E)-(4-methoxyphenyl)methylideneamino]-6-methyl-4-phenyl-[1,2,4]triazino[2,3-c]quinazolin-3-amine.
| Compound Name | 10-bromo-N-[(E)-(4-methoxyphenyl)methylideneamino]-6-methyl-4-phenyl-[1,2,4]triazino[2,3-c]quinazolin-3-amine |
|---|---|
| PubChem CID | 10673027 |
| Molecular Formula | C25H21BrN6O |
| Molecular Weight | 501.39 g/mol |
| Exact Mass | 500.10 |
| IUPAC Name | 10-bromo-N-[(E)-(4-methoxyphenyl)methylideneamino]-6-methyl-4-phenyl-[1,2,4]triazino[2,3-c]quinazolin-3-amine |
| SMILES | COc1ccc(/C=N/NC2=CN=C3c4cc(Br)ccc4N=C(C)N3N2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H21BrN6O/c1-17-29-23-13-10-19(26)14-22(23)25-27-16-24(32(31(17)25)20-6-4-3-5-7-20)30-28-15-18-8-11-21(33-2)12-9-18/h3-16,30H,1-2H3/b28-15+ |
| InChIKey | OABIVKAPMNJZSE-RWPZCVJISA-N |
| XLogP | 5.43 |
| TPSA | 64.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.39 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|