C26H29BrFN7O2 — CID 50870679
N-[(E)-[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine (PubChem CID 50870679) has the molecular formula C26H29BrFN7O2 and a molecular weight of 570.47 g/mol. Its IUPAC name is N-[(E)-[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(E)-[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 50870679 |
| Molecular Formula | C26H29BrFN7O2 |
| Molecular Weight | 570.47 g/mol |
| Exact Mass | 569.16 |
| IUPAC Name | N-[(E)-[5-bromo-2-[(2-fluorophenyl)methoxy]phenyl]methylideneamino]-4-morpholin-4-yl-6-piperidin-1-yl-1,3,5-triazin-2-amine |
| SMILES | Fc1ccccc1COc1ccc(Br)cc1/C=N/Nc1nc(N2CCCCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C26H29BrFN7O2/c27-21-8-9-23(37-18-19-6-2-3-7-22(19)28)20(16-21)17-29-33-24-30-25(34-10-4-1-5-11-34)32-26(31-24)35-12-14-36-15-13-35/h2-3,6-9,16-17H,1,4-5,10-15,18H2,(H,30,31,32,33)/b29-17+ |
| InChIKey | KMJWYIKUQYPJKJ-STBIYBPSSA-N |
| XLogP | 4.63 |
| TPSA | 88.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.47 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|