C24H30N8O2 — CID 6081116
N-[(Z)-(2,4-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine (PubChem CID 6081116) has the molecular formula C24H30N8O2 and a molecular weight of 462.56 g/mol. Its IUPAC name is N-[(Z)-(2,4-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine.
| Compound Name | N-[(Z)-(2,4-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 6081116 |
| Molecular Formula | C24H30N8O2 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.25 |
| IUPAC Name | N-[(Z)-(2,4-dimethyl-1-phenylpyrrol-3-yl)methylideneamino]-4,6-dimorpholin-4-yl-1,3,5-triazin-2-amine |
| SMILES | Cc1cn(-c2ccccc2)c(C)c1/C=N\Nc1nc(N2CCOCC2)nc(N2CCOCC2)n1 |
| InChI | InChI=1S/C24H30N8O2/c1-18-17-32(20-6-4-3-5-7-20)19(2)21(18)16-25-29-22-26-23(30-8-12-33-13-9-30)28-24(27-22)31-10-14-34-15-11-31/h3-7,16-17H,8-15H2,1-2H3,(H,26,27,28,29)/b25-16- |
| InChIKey | WAOICBCOTNRDAO-XYGWBWBKSA-N |
| XLogP | 2.40 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|