C18H23N5O — CID 5368217
2-methyl-N-[(Z)-1-(4-methylphenyl)ethylideneamino]-6-morpholin-4-ylpyrimidin-4-amine (PubChem CID 5368217) has the molecular formula C18H23N5O and a molecular weight of 325.42 g/mol. Its IUPAC name is 2-methyl-N-[(Z)-1-(4-methylphenyl)ethylideneamino]-6-morpholin-4-ylpyrimidin-4-amine.
| Compound Name | 2-methyl-N-[(Z)-1-(4-methylphenyl)ethylideneamino]-6-morpholin-4-ylpyrimidin-4-amine |
|---|---|
| PubChem CID | 5368217 |
| Molecular Formula | C18H23N5O |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.19 |
| IUPAC Name | 2-methyl-N-[(Z)-1-(4-methylphenyl)ethylideneamino]-6-morpholin-4-ylpyrimidin-4-amine |
| SMILES | C/C(=N/Nc1cc(N2CCOCC2)nc(C)n1)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H23N5O/c1-13-4-6-16(7-5-13)14(2)21-22-17-12-18(20-15(3)19-17)23-8-10-24-11-9-23/h4-7,12H,8-11H2,1-3H3,(H,19,20,22)/b21-14- |
| InChIKey | HGSHQYOJJGNIMV-STZFKDTASA-N |
| XLogP | 2.77 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|