C20H19FN4 — CID 59846647
6-(2-fluorophenyl)-2-methyl-N-[(E)-1-(4-methylphenyl)ethylideneamino]pyrimidin-4-amine (PubChem CID 59846647) has the molecular formula C20H19FN4 and a molecular weight of 334.40 g/mol. Its IUPAC name is 6-(2-fluorophenyl)-2-methyl-N-[(E)-1-(4-methylphenyl)ethylideneamino]pyrimidin-4-amine.
| Compound Name | 6-(2-fluorophenyl)-2-methyl-N-[(E)-1-(4-methylphenyl)ethylideneamino]pyrimidin-4-amine |
|---|---|
| PubChem CID | 59846647 |
| Molecular Formula | C20H19FN4 |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 6-(2-fluorophenyl)-2-methyl-N-[(E)-1-(4-methylphenyl)ethylideneamino]pyrimidin-4-amine |
| SMILES | C/C(=N\Nc1cc(-c2ccccc2F)nc(C)n1)c1ccc(C)cc1 |
| InChI | InChI=1S/C20H19FN4/c1-13-8-10-16(11-9-13)14(2)24-25-20-12-19(22-15(3)23-20)17-6-4-5-7-18(17)21/h4-12H,1-3H3,(H,22,23,25)/b24-14+ |
| InChIKey | XCMHIRILCLNUKG-ZVHZXABRSA-N |
| XLogP | 4.74 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|