C20H20N6S — CID 72577517
[4-[C-methyl-N-[(2-methyl-6-phenylpyrimidin-4-yl)amino]carbonimidoyl]phenyl]thiourea (PubChem CID 72577517) has the molecular formula C20H20N6S and a molecular weight of 376.49 g/mol. Its IUPAC name is [4-[C-methyl-N-[(2-methyl-6-phenylpyrimidin-4-yl)amino]carbonimidoyl]phenyl]thiourea.
| Compound Name | [4-[C-methyl-N-[(2-methyl-6-phenylpyrimidin-4-yl)amino]carbonimidoyl]phenyl]thiourea |
|---|---|
| PubChem CID | 72577517 |
| Molecular Formula | C20H20N6S |
| Molecular Weight | 376.49 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | [4-[C-methyl-N-[(2-methyl-6-phenylpyrimidin-4-yl)amino]carbonimidoyl]phenyl]thiourea |
| SMILES | CC(=NNc1cc(-c2ccccc2)nc(C)n1)c1ccc(NC(N)=S)cc1 |
| InChI | InChI=1S/C20H20N6S/c1-13(15-8-10-17(11-9-15)24-20(21)27)25-26-19-12-18(22-14(2)23-19)16-6-4-3-5-7-16/h3-12H,1-2H3,(H3,21,24,27)(H,22,23,26) |
| InChIKey | LLDPEBSTDNSMMX-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 88.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|