C21H22N2O5 — CID 35934971
N'-[2-(5,6-dimethyl-1-benzofuran-3-yl)acetyl]-3,4-dimethoxybenzohydrazide (PubChem CID 35934971) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is N'-[2-(5,6-dimethyl-1-benzofuran-3-yl)acetyl]-3,4-dimethoxybenzohydrazide.
| Compound Name | N'-[2-(5,6-dimethyl-1-benzofuran-3-yl)acetyl]-3,4-dimethoxybenzohydrazide |
|---|---|
| PubChem CID | 35934971 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | N'-[2-(5,6-dimethyl-1-benzofuran-3-yl)acetyl]-3,4-dimethoxybenzohydrazide |
| SMILES | COc1ccc(C(=O)NNC(=O)Cc2coc3cc(C)c(C)cc23)cc1OC |
| InChI | InChI=1S/C21H22N2O5/c1-12-7-16-15(11-28-18(16)8-13(12)2)10-20(24)22-23-21(25)14-5-6-17(26-3)19(9-14)27-4/h5-9,11H,10H2,1-4H3,(H,22,24)(H,23,25) |
| InChIKey | RPPKVTPEAMVYRN-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|