C22H24N2O5 — CID 18270509
3-methoxy-N'-[2-(6-methyl-1-benzofuran-3-yl)acetyl]-4-propan-2-yloxybenzohydrazide (PubChem CID 18270509) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is 3-methoxy-N'-[2-(6-methyl-1-benzofuran-3-yl)acetyl]-4-propan-2-yloxybenzohydrazide.
| Compound Name | 3-methoxy-N'-[2-(6-methyl-1-benzofuran-3-yl)acetyl]-4-propan-2-yloxybenzohydrazide |
|---|---|
| PubChem CID | 18270509 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | 3-methoxy-N'-[2-(6-methyl-1-benzofuran-3-yl)acetyl]-4-propan-2-yloxybenzohydrazide |
| SMILES | COc1cc(C(=O)NNC(=O)Cc2coc3cc(C)ccc23)ccc1OC(C)C |
| InChI | InChI=1S/C22H24N2O5/c1-13(2)29-18-8-6-15(10-20(18)27-4)22(26)24-23-21(25)11-16-12-28-19-9-14(3)5-7-17(16)19/h5-10,12-13H,11H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | RWBCMXCCBCLWQE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|