About 1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate
1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate (PubChem CID 134033342) has the molecular formula C18H16N2O5
and a molecular weight of 340.34 g/mol. Its IUPAC name is 1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate.
Molecular Properties
| Compound Name | 1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate |
| PubChem CID | 134033342 |
| Molecular Formula | C18H16N2O5 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.11 |
| IUPAC Name | 1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate |
| SMILES | O=C(CCNc1ccccc1[N+](=O)[O-])OCc1cc2ccccc2o1 |
| InChI | InChI=1S/C18H16N2O5/c21-18(9-10-19-15-6-2-3-7-16(15)20(22)23)24-12-14-11-13-5-1-4-8-17(13)25-14/h1-8,11,19H,9-10,12H2 |
| InChIKey | QWWNCHUJEREWQP-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 94.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate?
The IUPAC name of 1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate (CID 134033342) is 1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate.
What is the SMILES notation for 1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate?
The canonical SMILES for 1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate is O=C(CCNc1ccccc1[N+](=O)[O-])OCc1cc2ccccc2o1.
What is the InChIKey of 1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate?
The InChIKey is QWWNCHUJEREWQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16N2O5/c21-18(9-10-19-15-6-2-3-7-16(15)20(22)23)24-12-14-11-13-5-1-4-8-17(13)25-14/h1-8,11,19H,9-10,12H2.
What are the key properties of 1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate?
1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate has a molecular weight of 340.34 g/mol, XLogP of 3.89, 7 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzofuran-2-ylmethyl 3-(2-nitroanilino)propanoate is sourced from PubChem (CID 134033342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).