C20H23NO4S — CID 67677254
2,3-dihydro-1H-inden-5-yl 3-[(4-ethylphenyl)sulfonylamino]propanoate (PubChem CID 67677254) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 2,3-dihydro-1H-inden-5-yl 3-[(4-ethylphenyl)sulfonylamino]propanoate.
| Compound Name | 2,3-dihydro-1H-inden-5-yl 3-[(4-ethylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 67677254 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2,3-dihydro-1H-inden-5-yl 3-[(4-ethylphenyl)sulfonylamino]propanoate |
| SMILES | CCc1ccc(S(=O)(=O)NCCC(=O)Oc2ccc3c(c2)CCC3)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-2-15-6-10-19(11-7-15)26(23,24)21-13-12-20(22)25-18-9-8-16-4-3-5-17(16)14-18/h6-11,14,21H,2-5,12-13H2,1H3 |
| InChIKey | WSABXPWWXHFXEP-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|