C20H22N2O6S — CID 7829798
(4-nitrophenyl)methyl 3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanoate (PubChem CID 7829798) has the molecular formula C20H22N2O6S and a molecular weight of 418.47 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanoate.
| Compound Name | (4-nitrophenyl)methyl 3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanoate |
|---|---|
| PubChem CID | 7829798 |
| Molecular Formula | C20H22N2O6S |
| Molecular Weight | 418.47 g/mol |
| Exact Mass | 418.12 |
| IUPAC Name | (4-nitrophenyl)methyl 3-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)propanoate |
| SMILES | O=C(CCNS(=O)(=O)c1ccc2c(c1)CCCC2)OCc1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H22N2O6S/c23-20(28-14-15-5-8-18(9-6-15)22(24)25)11-12-21-29(26,27)19-10-7-16-3-1-2-4-17(16)13-19/h5-10,13,21H,1-4,11-12,14H2 |
| InChIKey | QPMIRZLCEGOMOK-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.47 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|