C20H24N2O6S — CID 7828815
(4-nitrophenyl)methyl 3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]propanoate (PubChem CID 7828815) has the molecular formula C20H24N2O6S and a molecular weight of 420.49 g/mol. Its IUPAC name is (4-nitrophenyl)methyl 3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]propanoate.
| Compound Name | (4-nitrophenyl)methyl 3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]propanoate |
|---|---|
| PubChem CID | 7828815 |
| Molecular Formula | C20H24N2O6S |
| Molecular Weight | 420.49 g/mol |
| Exact Mass | 420.14 |
| IUPAC Name | (4-nitrophenyl)methyl 3-[(2,3,5,6-tetramethylphenyl)sulfonylamino]propanoate |
| SMILES | Cc1cc(C)c(C)c(S(=O)(=O)NCCC(=O)OCc2ccc([N+](=O)[O-])cc2)c1C |
| InChI | InChI=1S/C20H24N2O6S/c1-13-11-14(2)16(4)20(15(13)3)29(26,27)21-10-9-19(23)28-12-17-5-7-18(8-6-17)22(24)25/h5-8,11,21H,9-10,12H2,1-4H3 |
| InChIKey | DRHRAAIMRQOXDY-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 115.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.49 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|