C21H23NO6S — CID 9455692
ethyl 4-[2-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)acetyl]oxybenzoate (PubChem CID 9455692) has the molecular formula C21H23NO6S and a molecular weight of 417.48 g/mol. Its IUPAC name is ethyl 4-[2-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)acetyl]oxybenzoate.
| Compound Name | ethyl 4-[2-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)acetyl]oxybenzoate |
|---|---|
| PubChem CID | 9455692 |
| Molecular Formula | C21H23NO6S |
| Molecular Weight | 417.48 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | ethyl 4-[2-(5,6,7,8-tetrahydronaphthalen-2-ylsulfonylamino)acetyl]oxybenzoate |
| SMILES | CCOC(=O)c1ccc(OC(=O)CNS(=O)(=O)c2ccc3c(c2)CCCC3)cc1 |
| InChI | InChI=1S/C21H23NO6S/c1-2-27-21(24)16-7-10-18(11-8-16)28-20(23)14-22-29(25,26)19-12-9-15-5-3-4-6-17(15)13-19/h7-13,22H,2-6,14H2,1H3 |
| InChIKey | DMHQWRIEMOOSSV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.48 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|