C16H18N2O7S — CID 9455723
ethyl 4-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]acetyl]oxybenzoate (PubChem CID 9455723) has the molecular formula C16H18N2O7S and a molecular weight of 382.39 g/mol. Its IUPAC name is ethyl 4-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]acetyl]oxybenzoate.
| Compound Name | ethyl 4-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]acetyl]oxybenzoate |
|---|---|
| PubChem CID | 9455723 |
| Molecular Formula | C16H18N2O7S |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.08 |
| IUPAC Name | ethyl 4-[2-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonylamino]acetyl]oxybenzoate |
| SMILES | CCOC(=O)c1ccc(OC(=O)CNS(=O)(=O)c2c(C)noc2C)cc1 |
| InChI | InChI=1S/C16H18N2O7S/c1-4-23-16(20)12-5-7-13(8-6-12)24-14(19)9-17-26(21,22)15-10(2)18-25-11(15)3/h5-8,17H,4,9H2,1-3H3 |
| InChIKey | ZGTOHEXTVNJVRV-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 124.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|