C18H25N3O5S — CID 8617635
N'-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-hexoxybenzohydrazide (PubChem CID 8617635) has the molecular formula C18H25N3O5S and a molecular weight of 395.48 g/mol. Its IUPAC name is N'-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-hexoxybenzohydrazide.
| Compound Name | N'-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-hexoxybenzohydrazide |
|---|---|
| PubChem CID | 8617635 |
| Molecular Formula | C18H25N3O5S |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N'-[(3,5-dimethyl-1,2-oxazol-4-yl)sulfonyl]-4-hexoxybenzohydrazide |
| SMILES | CCCCCCOc1ccc(C(=O)NNS(=O)(=O)c2c(C)noc2C)cc1 |
| InChI | InChI=1S/C18H25N3O5S/c1-4-5-6-7-12-25-16-10-8-15(9-11-16)18(22)19-21-27(23,24)17-13(2)20-26-14(17)3/h8-11,21H,4-7,12H2,1-3H3,(H,19,22) |
| InChIKey | ISFKOUUZGKIQKN-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|