C20H23FN2O4S — CID 55953414
N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-[(4-fluorophenyl)sulfonylamino]propanamide (PubChem CID 55953414) has the molecular formula C20H23FN2O4S and a molecular weight of 406.48 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-[(4-fluorophenyl)sulfonylamino]propanamide.
| Compound Name | N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-[(4-fluorophenyl)sulfonylamino]propanamide |
|---|---|
| PubChem CID | 55953414 |
| Molecular Formula | C20H23FN2O4S |
| Molecular Weight | 406.48 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-inden-5-yloxy)ethyl]-3-[(4-fluorophenyl)sulfonylamino]propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(F)cc1)NCCOc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C20H23FN2O4S/c21-17-5-8-19(9-6-17)28(25,26)23-11-10-20(24)22-12-13-27-18-7-4-15-2-1-3-16(15)14-18/h4-9,14,23H,1-3,10-13H2,(H,22,24) |
| InChIKey | LYKQDWLIPYSMJX-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.48 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|