C17H20N2O5S2 — CID 18283523
[2-[(4-ethylphenyl)methyl-methylamino]-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate (PubChem CID 18283523) has the molecular formula C17H20N2O5S2 and a molecular weight of 396.49 g/mol. Its IUPAC name is [2-[(4-ethylphenyl)methyl-methylamino]-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate.
| Compound Name | [2-[(4-ethylphenyl)methyl-methylamino]-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 18283523 |
| Molecular Formula | C17H20N2O5S2 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.08 |
| IUPAC Name | [2-[(4-ethylphenyl)methyl-methylamino]-2-oxoethyl] 5-sulfamoylthiophene-3-carboxylate |
| SMILES | CCc1ccc(CN(C)C(=O)COC(=O)c2csc(S(N)(=O)=O)c2)cc1 |
| InChI | InChI=1S/C17H20N2O5S2/c1-3-12-4-6-13(7-5-12)9-19(2)15(20)10-24-17(21)14-8-16(25-11-14)26(18,22)23/h4-8,11H,3,9-10H2,1-2H3,(H2,18,22,23) |
| InChIKey | NBIQXUYBVDZEEP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 106.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |