C14H14F2N2O4S2 — CID 51270529
N-[[4-(difluoromethoxy)phenyl]methyl]-N-methyl-5-sulfamoylthiophene-3-carboxamide (PubChem CID 51270529) has the molecular formula C14H14F2N2O4S2 and a molecular weight of 376.41 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-N-methyl-5-sulfamoylthiophene-3-carboxamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-N-methyl-5-sulfamoylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 51270529 |
| Molecular Formula | C14H14F2N2O4S2 |
| Molecular Weight | 376.41 g/mol |
| Exact Mass | 376.04 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-N-methyl-5-sulfamoylthiophene-3-carboxamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)c1csc(S(N)(=O)=O)c1 |
| InChI | InChI=1S/C14H14F2N2O4S2/c1-18(7-9-2-4-11(5-3-9)22-14(15)16)13(19)10-6-12(23-8-10)24(17,20)21/h2-6,8,14H,7H2,1H3,(H2,17,20,21) |
| InChIKey | QIFHHUQCKWWUHH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.41 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |