C17H15F4NO2S — CID 55518274
N-[[4-(difluoromethoxy)phenyl]methyl]-4-(difluoromethylsulfanyl)-N-methylbenzamide (PubChem CID 55518274) has the molecular formula C17H15F4NO2S and a molecular weight of 373.37 g/mol. Its IUPAC name is N-[[4-(difluoromethoxy)phenyl]methyl]-4-(difluoromethylsulfanyl)-N-methylbenzamide.
| Compound Name | N-[[4-(difluoromethoxy)phenyl]methyl]-4-(difluoromethylsulfanyl)-N-methylbenzamide |
|---|---|
| PubChem CID | 55518274 |
| Molecular Formula | C17H15F4NO2S |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | N-[[4-(difluoromethoxy)phenyl]methyl]-4-(difluoromethylsulfanyl)-N-methylbenzamide |
| SMILES | CN(Cc1ccc(OC(F)F)cc1)C(=O)c1ccc(SC(F)F)cc1 |
| InChI | InChI=1S/C17H15F4NO2S/c1-22(10-11-2-6-13(7-3-11)24-16(18)19)15(23)12-4-8-14(9-5-12)25-17(20)21/h2-9,16-17H,10H2,1H3 |
| InChIKey | YSNGKONYJQZTPP-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |