C19H17F2N3O2 — CID 70751227
4-(difluoromethoxy)-N-methyl-N-[(3-pyrazol-1-ylphenyl)methyl]benzamide (PubChem CID 70751227) has the molecular formula C19H17F2N3O2 and a molecular weight of 357.36 g/mol. Its IUPAC name is 4-(difluoromethoxy)-N-methyl-N-[(3-pyrazol-1-ylphenyl)methyl]benzamide.
| Compound Name | 4-(difluoromethoxy)-N-methyl-N-[(3-pyrazol-1-ylphenyl)methyl]benzamide |
|---|---|
| PubChem CID | 70751227 |
| Molecular Formula | C19H17F2N3O2 |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.13 |
| IUPAC Name | 4-(difluoromethoxy)-N-methyl-N-[(3-pyrazol-1-ylphenyl)methyl]benzamide |
| SMILES | CN(Cc1cccc(-n2cccn2)c1)C(=O)c1ccc(OC(F)F)cc1 |
| InChI | InChI=1S/C19H17F2N3O2/c1-23(18(25)15-6-8-17(9-7-15)26-19(20)21)13-14-4-2-5-16(12-14)24-11-3-10-22-24/h2-12,19H,13H2,1H3 |
| InChIKey | PKVNVJVXLKHWFV-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |