C22H22N4O — CID 70786181
N,2,3-trimethyl-N-[(3-pyrazol-1-ylphenyl)methyl]-1H-indole-7-carboxamide (PubChem CID 70786181) has the molecular formula C22H22N4O and a molecular weight of 358.44 g/mol. Its IUPAC name is N,2,3-trimethyl-N-[(3-pyrazol-1-ylphenyl)methyl]-1H-indole-7-carboxamide.
| Compound Name | N,2,3-trimethyl-N-[(3-pyrazol-1-ylphenyl)methyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 70786181 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N,2,3-trimethyl-N-[(3-pyrazol-1-ylphenyl)methyl]-1H-indole-7-carboxamide |
| SMILES | Cc1[nH]c2c(C(=O)N(C)Cc3cccc(-n4cccn4)c3)cccc2c1C |
| InChI | InChI=1S/C22H22N4O/c1-15-16(2)24-21-19(15)9-5-10-20(21)22(27)25(3)14-17-7-4-8-18(13-17)26-12-6-11-23-26/h4-13,24H,14H2,1-3H3 |
| InChIKey | FYZRXQHCNMXQPN-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 53.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|