C17H19N3OS — CID 86853868
N,2,3-trimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-7-carboxamide (PubChem CID 86853868) has the molecular formula C17H19N3OS and a molecular weight of 313.43 g/mol. Its IUPAC name is N,2,3-trimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-7-carboxamide.
| Compound Name | N,2,3-trimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 86853868 |
| Molecular Formula | C17H19N3OS |
| Molecular Weight | 313.43 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | N,2,3-trimethyl-N-[(2-methyl-1,3-thiazol-4-yl)methyl]-1H-indole-7-carboxamide |
| SMILES | Cc1nc(CN(C)C(=O)c2cccc3c(C)c(C)[nH]c23)cs1 |
| InChI | InChI=1S/C17H19N3OS/c1-10-11(2)18-16-14(10)6-5-7-15(16)17(21)20(4)8-13-9-22-12(3)19-13/h5-7,9,18H,8H2,1-4H3 |
| InChIKey | PHODCOITBOJSPY-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.43 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|