C20H24N4OS — CID 38472860
(2,3-dimethyl-1H-indol-7-yl)-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methanone (PubChem CID 38472860) has the molecular formula C20H24N4OS and a molecular weight of 368.51 g/mol. Its IUPAC name is (2,3-dimethyl-1H-indol-7-yl)-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methanone.
| Compound Name | (2,3-dimethyl-1H-indol-7-yl)-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 38472860 |
| Molecular Formula | C20H24N4OS |
| Molecular Weight | 368.51 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | (2,3-dimethyl-1H-indol-7-yl)-[4-[(2-methyl-1,3-thiazol-4-yl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1nc(CN2CCN(C(=O)c3cccc4c(C)c(C)[nH]c34)CC2)cs1 |
| InChI | InChI=1S/C20H24N4OS/c1-13-14(2)21-19-17(13)5-4-6-18(19)20(25)24-9-7-23(8-10-24)11-16-12-26-15(3)22-16/h4-6,12,21H,7-11H2,1-3H3 |
| InChIKey | VQLQGYBEZSSSMQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.51 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|