C15H11FO5 — CID 7913572
1,3-benzodioxol-5-yl 2-(2-fluorophenoxy)acetate (PubChem CID 7913572) has the molecular formula C15H11FO5 and a molecular weight of 290.25 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 2-(2-fluorophenoxy)acetate.
| Compound Name | 1,3-benzodioxol-5-yl 2-(2-fluorophenoxy)acetate |
|---|---|
| PubChem CID | 7913572 |
| Molecular Formula | C15H11FO5 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 1,3-benzodioxol-5-yl 2-(2-fluorophenoxy)acetate |
| SMILES | O=C(COc1ccccc1F)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H11FO5/c16-11-3-1-2-4-12(11)18-8-15(17)21-10-5-6-13-14(7-10)20-9-19-13/h1-7H,8-9H2 |
| InChIKey | SXJMQQKFTFWXRH-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|