C19H17NO5 — CID 31038351
1,3-benzodioxol-5-yl 3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate (PubChem CID 31038351) has the molecular formula C19H17NO5 and a molecular weight of 339.35 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl 3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate.
| Compound Name | 1,3-benzodioxol-5-yl 3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate |
|---|---|
| PubChem CID | 31038351 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1,3-benzodioxol-5-yl 3-[(3R)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate |
| SMILES | O=C(CC[C@@H]1Cc2ccccc2NC1=O)Oc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C19H17NO5/c21-18(25-14-6-7-16-17(10-14)24-11-23-16)8-5-13-9-12-3-1-2-4-15(12)20-19(13)22/h1-4,6-7,10,13H,5,8-9,11H2,(H,20,22)/t13-/m1/s1 |
| InChIKey | KQIMSKKKJUZPDO-CYBMUJFWSA-N |
| XLogP | 2.91 |
| TPSA | 73.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|