C18H15BrClNO3 — CID 26262429
(4-bromo-2-chlorophenyl) 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate (PubChem CID 26262429) has the molecular formula C18H15BrClNO3 and a molecular weight of 408.68 g/mol. Its IUPAC name is (4-bromo-2-chlorophenyl) 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate.
| Compound Name | (4-bromo-2-chlorophenyl) 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate |
|---|---|
| PubChem CID | 26262429 |
| Molecular Formula | C18H15BrClNO3 |
| Molecular Weight | 408.68 g/mol |
| Exact Mass | 406.99 |
| IUPAC Name | (4-bromo-2-chlorophenyl) 3-[(3S)-2-oxo-3,4-dihydro-1H-quinolin-3-yl]propanoate |
| SMILES | O=C(CC[C@H]1Cc2ccccc2NC1=O)Oc1ccc(Br)cc1Cl |
| InChI | InChI=1S/C18H15BrClNO3/c19-13-6-7-16(14(20)10-13)24-17(22)8-5-12-9-11-3-1-2-4-15(11)21-18(12)23/h1-4,6-7,10,12H,5,8-9H2,(H,21,23)/t12-/m0/s1 |
| InChIKey | FIJSQSNICKILBP-LBPRGKRZSA-N |
| XLogP | 4.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.68 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|