C11H15NO5S — CID 94697951
2-[2-(1,3-benzodioxol-5-ylsulfonyl)ethoxy]ethanamine (PubChem CID 94697951) has the molecular formula C11H15NO5S and a molecular weight of 273.31 g/mol. Its IUPAC name is 2-[2-(1,3-benzodioxol-5-ylsulfonyl)ethoxy]ethanamine.
| Compound Name | 2-[2-(1,3-benzodioxol-5-ylsulfonyl)ethoxy]ethanamine |
|---|---|
| PubChem CID | 94697951 |
| Molecular Formula | C11H15NO5S |
| Molecular Weight | 273.31 g/mol |
| Exact Mass | 273.07 |
| IUPAC Name | 2-[2-(1,3-benzodioxol-5-ylsulfonyl)ethoxy]ethanamine |
| SMILES | NCCOCCS(=O)(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H15NO5S/c12-3-4-15-5-6-18(13,14)9-1-2-10-11(7-9)17-8-16-10/h1-2,7H,3-6,8,12H2 |
| InChIKey | BTJAYCDNNVBEFA-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 87.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.31 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|