C23H23N2O2+ — CID 2165207
1,3-benzodioxol-5-ylmethyl-[(9-ethylcarbazol-3-yl)methyl]azanium (PubChem CID 2165207) has the molecular formula C23H23N2O2+ and a molecular weight of 359.45 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl-[(9-ethylcarbazol-3-yl)methyl]azanium.
| Compound Name | 1,3-benzodioxol-5-ylmethyl-[(9-ethylcarbazol-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 2165207 |
| Molecular Formula | C23H23N2O2+ |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl-[(9-ethylcarbazol-3-yl)methyl]azanium |
| SMILES | CCn1c2ccccc2c2cc(C[NH2+]Cc3ccc4c(c3)OCO4)ccc21 |
| InChI | InChI=1S/C23H22N2O2/c1-2-25-20-6-4-3-5-18(20)19-11-16(7-9-21(19)25)13-24-14-17-8-10-22-23(12-17)27-15-26-22/h3-12,24H,2,13-15H2,1H3/p+1 |
| InChIKey | YTSINFAHHBQRPJ-UHFFFAOYSA-O |
| XLogP | 3.81 |
| TPSA | 40.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |