C19H24ClN3 — CID 156592203
9-ethyl-3-(piperazin-1-ylmethyl)carbazole;hydrochloride (PubChem CID 156592203) has the molecular formula C19H24ClN3 and a molecular weight of 329.88 g/mol. Its IUPAC name is 9-ethyl-3-(piperazin-1-ylmethyl)carbazole;hydrochloride.
| Compound Name | 9-ethyl-3-(piperazin-1-ylmethyl)carbazole;hydrochloride |
|---|---|
| PubChem CID | 156592203 |
| Molecular Formula | C19H24ClN3 |
| Molecular Weight | 329.88 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 9-ethyl-3-(piperazin-1-ylmethyl)carbazole;hydrochloride |
| SMILES | CCn1c2ccccc2c2cc(CN3CCNCC3)ccc21.Cl |
| InChI | InChI=1S/C19H23N3.ClH/c1-2-22-18-6-4-3-5-16(18)17-13-15(7-8-19(17)22)14-21-11-9-20-10-12-21;/h3-8,13,20H,2,9-12,14H2,1H3;1H |
| InChIKey | DKTFXRHHINDXNO-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 20.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.88 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |