C24H25N2O2+ — CID 7026639
2-(1,3-benzodioxol-5-yl)ethyl-[(9-ethylcarbazol-3-yl)methyl]azanium (PubChem CID 7026639) has the molecular formula C24H25N2O2+ and a molecular weight of 373.48 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)ethyl-[(9-ethylcarbazol-3-yl)methyl]azanium.
| Compound Name | 2-(1,3-benzodioxol-5-yl)ethyl-[(9-ethylcarbazol-3-yl)methyl]azanium |
|---|---|
| PubChem CID | 7026639 |
| Molecular Formula | C24H25N2O2+ |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)ethyl-[(9-ethylcarbazol-3-yl)methyl]azanium |
| SMILES | CCn1c2ccccc2c2cc(C[NH2+]CCc3ccc4c(c3)OCO4)ccc21 |
| InChI | InChI=1S/C24H24N2O2/c1-2-26-21-6-4-3-5-19(21)20-13-18(7-9-22(20)26)15-25-12-11-17-8-10-23-24(14-17)28-16-27-23/h3-10,13-14,25H,2,11-12,15-16H2,1H3/p+1 |
| InChIKey | CNLUJCLUKUPZOQ-UHFFFAOYSA-O |
| XLogP | 3.85 |
| TPSA | 40.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|