C15H17N2O2+ — CID 6997529
2-(1,3-benzodioxol-5-yl)ethyl-(pyridin-3-ylmethyl)azanium (PubChem CID 6997529) has the molecular formula C15H17N2O2+ and a molecular weight of 257.31 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yl)ethyl-(pyridin-3-ylmethyl)azanium.
| Compound Name | 2-(1,3-benzodioxol-5-yl)ethyl-(pyridin-3-ylmethyl)azanium |
|---|---|
| PubChem CID | 6997529 |
| Molecular Formula | C15H17N2O2+ |
| Molecular Weight | 257.31 g/mol |
| Exact Mass | 257.13 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yl)ethyl-(pyridin-3-ylmethyl)azanium |
| SMILES | c1cncc(C[NH2+]CCc2ccc3c(c2)OCO3)c1 |
| InChI | InChI=1S/C15H16N2O2/c1-2-13(9-16-6-1)10-17-7-5-12-3-4-14-15(8-12)19-11-18-14/h1-4,6,8-9,17H,5,7,10-11H2/p+1 |
| InChIKey | LDMRKSJFXOVPPD-UHFFFAOYSA-O |
| XLogP | 1.12 |
| TPSA | 47.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.31 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|