C19H18ClNO2S2 — CID 110182033
1,3-benzodioxol-5-ylmethyl-[3,3-di(thiophen-3-yl)prop-2-enyl]azanium chloride (PubChem CID 110182033) has the molecular formula C19H18ClNO2S2 and a molecular weight of 391.95 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl-[3,3-di(thiophen-3-yl)prop-2-enyl]azanium chloride.
| Compound Name | 1,3-benzodioxol-5-ylmethyl-[3,3-di(thiophen-3-yl)prop-2-enyl]azanium chloride |
|---|---|
| PubChem CID | 110182033 |
| Molecular Formula | C19H18ClNO2S2 |
| Molecular Weight | 391.95 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl-[3,3-di(thiophen-3-yl)prop-2-enyl]azanium chloride |
| SMILES | C(C[NH2+]Cc1ccc2c(c1)OCO2)=C(c1ccsc1)c1ccsc1.[Cl-] |
| InChI | InChI=1S/C19H17NO2S2.ClH/c1-2-18-19(22-13-21-18)9-14(1)10-20-6-3-17(15-4-7-23-11-15)16-5-8-24-12-16;/h1-5,7-9,11-12,20H,6,10,13H2;1H |
| InChIKey | OFPMMNRPAKMHCZ-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 35.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.95 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|