C15H14N2O4S — CID 30267459
N-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]thiophene-3-carboxamide (PubChem CID 30267459) has the molecular formula C15H14N2O4S and a molecular weight of 318.35 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]thiophene-3-carboxamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 30267459 |
| Molecular Formula | C15H14N2O4S |
| Molecular Weight | 318.35 g/mol |
| Exact Mass | 318.07 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]thiophene-3-carboxamide |
| SMILES | O=C(CCNC(=O)c1ccsc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H14N2O4S/c18-14(3-5-16-15(19)10-4-6-22-8-10)17-11-1-2-12-13(7-11)21-9-20-12/h1-2,4,6-8H,3,5,9H2,(H,16,19)(H,17,18) |
| InChIKey | AUUUNQYEPIZFOD-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.35 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |