C18H18N2O5 — CID 110370640
benzyl N-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]carbamate (PubChem CID 110370640) has the molecular formula C18H18N2O5 and a molecular weight of 342.35 g/mol. Its IUPAC name is benzyl N-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]carbamate.
| Compound Name | benzyl N-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]carbamate |
|---|---|
| PubChem CID | 110370640 |
| Molecular Formula | C18H18N2O5 |
| Molecular Weight | 342.35 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | benzyl N-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]carbamate |
| SMILES | O=C(CCNC(=O)OCc1ccccc1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C18H18N2O5/c21-17(20-14-6-7-15-16(10-14)25-12-24-15)8-9-19-18(22)23-11-13-4-2-1-3-5-13/h1-7,10H,8-9,11-12H2,(H,19,22)(H,20,21) |
| InChIKey | MOZSMPNZTYRBBD-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.35 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |