C16H20N2O4 — CID 38766641
N-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]cyclopentanecarboxamide (PubChem CID 38766641) has the molecular formula C16H20N2O4 and a molecular weight of 304.35 g/mol. Its IUPAC name is N-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]cyclopentanecarboxamide.
| Compound Name | N-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]cyclopentanecarboxamide |
|---|---|
| PubChem CID | 38766641 |
| Molecular Formula | C16H20N2O4 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.14 |
| IUPAC Name | N-[3-(1,3-benzodioxol-5-ylamino)-3-oxopropyl]cyclopentanecarboxamide |
| SMILES | O=C(CCNC(=O)C1CCCC1)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H20N2O4/c19-15(7-8-17-16(20)11-3-1-2-4-11)18-12-5-6-13-14(9-12)22-10-21-13/h5-6,9,11H,1-4,7-8,10H2,(H,17,20)(H,18,19) |
| InChIKey | YVFOXPRQJLEABW-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |