C16H16BrNO3 — CID 60734425
2-(1,3-benzodioxol-5-ylmethylamino)-1-(3-bromophenyl)ethanol (PubChem CID 60734425) has the molecular formula C16H16BrNO3 and a molecular weight of 350.21 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethylamino)-1-(3-bromophenyl)ethanol.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethylamino)-1-(3-bromophenyl)ethanol |
|---|---|
| PubChem CID | 60734425 |
| Molecular Formula | C16H16BrNO3 |
| Molecular Weight | 350.21 g/mol |
| Exact Mass | 349.03 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethylamino)-1-(3-bromophenyl)ethanol |
| SMILES | OC(CNCc1ccc2c(c1)OCO2)c1cccc(Br)c1 |
| InChI | InChI=1S/C16H16BrNO3/c17-13-3-1-2-12(7-13)14(19)9-18-8-11-4-5-15-16(6-11)21-10-20-15/h1-7,14,18-19H,8-10H2 |
| InChIKey | YIXFIEAZHRJWPC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 50.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.21 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |