C28H24N2O5 — CID 97289118
(4Z)-2-(1,3-benzodioxol-5-ylmethyl)-4-[(4-morpholin-4-ylphenyl)methylidene]isoquinoline-1,3-dione (PubChem CID 97289118) has the molecular formula C28H24N2O5 and a molecular weight of 468.51 g/mol. Its IUPAC name is (4Z)-2-(1,3-benzodioxol-5-ylmethyl)-4-[(4-morpholin-4-ylphenyl)methylidene]isoquinoline-1,3-dione.
| Compound Name | (4Z)-2-(1,3-benzodioxol-5-ylmethyl)-4-[(4-morpholin-4-ylphenyl)methylidene]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 97289118 |
| Molecular Formula | C28H24N2O5 |
| Molecular Weight | 468.51 g/mol |
| Exact Mass | 468.17 |
| IUPAC Name | (4Z)-2-(1,3-benzodioxol-5-ylmethyl)-4-[(4-morpholin-4-ylphenyl)methylidene]isoquinoline-1,3-dione |
| SMILES | O=C1/C(=C\c2ccc(N3CCOCC3)cc2)c2ccccc2C(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H24N2O5/c31-27-23-4-2-1-3-22(23)24(15-19-5-8-21(9-6-19)29-11-13-33-14-12-29)28(32)30(27)17-20-7-10-25-26(16-20)35-18-34-25/h1-10,15-16H,11-14,17-18H2/b24-15- |
| InChIKey | VBGOSYVTYSKGKI-IWIPYMOSSA-N |
| XLogP | 3.98 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.51 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|