C25H22N2O4 — CID 9007818
(2S)-3-(1,3-benzodioxol-5-ylmethyl)-2-(2-prop-2-enoxyphenyl)-1,2-dihydroquinazolin-4-one (PubChem CID 9007818) has the molecular formula C25H22N2O4 and a molecular weight of 414.46 g/mol. Its IUPAC name is (2S)-3-(1,3-benzodioxol-5-ylmethyl)-2-(2-prop-2-enoxyphenyl)-1,2-dihydroquinazolin-4-one.
| Compound Name | (2S)-3-(1,3-benzodioxol-5-ylmethyl)-2-(2-prop-2-enoxyphenyl)-1,2-dihydroquinazolin-4-one |
|---|---|
| PubChem CID | 9007818 |
| Molecular Formula | C25H22N2O4 |
| Molecular Weight | 414.46 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | (2S)-3-(1,3-benzodioxol-5-ylmethyl)-2-(2-prop-2-enoxyphenyl)-1,2-dihydroquinazolin-4-one |
| SMILES | C=CCOc1ccccc1[C@H]1Nc2ccccc2C(=O)N1Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C25H22N2O4/c1-2-13-29-21-10-6-4-8-19(21)24-26-20-9-5-3-7-18(20)25(28)27(24)15-17-11-12-22-23(14-17)31-16-30-22/h2-12,14,24,26H,1,13,15-16H2/t24-/m0/s1 |
| InChIKey | OQLGRLBLZLHGQK-DEOSSOPVSA-N |
| XLogP | 4.75 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.46 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|