C17H21N4O4S+ — CID 7546347
2-[[1-(1,3-benzodioxol-5-ylmethyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]ethyl-dimethylazanium (PubChem CID 7546347) has the molecular formula C17H21N4O4S+ and a molecular weight of 377.45 g/mol. Its IUPAC name is 2-[[1-(1,3-benzodioxol-5-ylmethyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]ethyl-dimethylazanium.
| Compound Name | 2-[[1-(1,3-benzodioxol-5-ylmethyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 7546347 |
| Molecular Formula | C17H21N4O4S+ |
| Molecular Weight | 377.45 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 2-[[1-(1,3-benzodioxol-5-ylmethyl)-4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl]methylideneamino]ethyl-dimethylazanium |
| SMILES | C[NH+](C)CC/N=C/C1C(=O)NC(=S)N(Cc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C17H20N4O4S/c1-20(2)6-5-18-8-12-15(22)19-17(26)21(16(12)23)9-11-3-4-13-14(7-11)25-10-24-13/h3-4,7-8,12H,5-6,9-10H2,1-2H3,(H,19,22,26)/p+1/b18-8+ |
| InChIKey | SVZHOPRNHDXCGY-QGMBQPNBSA-O |
| XLogP | -1.01 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.45 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|