C20H23N3O5 — CID 7695966
5-(1,3-benzodioxol-5-ylmethyliminomethyl)-1-cycloheptyl-1,3-diazinane-2,4,6-trione (PubChem CID 7695966) has the molecular formula C20H23N3O5 and a molecular weight of 385.42 g/mol. Its IUPAC name is 5-(1,3-benzodioxol-5-ylmethyliminomethyl)-1-cycloheptyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(1,3-benzodioxol-5-ylmethyliminomethyl)-1-cycloheptyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7695966 |
| Molecular Formula | C20H23N3O5 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 5-(1,3-benzodioxol-5-ylmethyliminomethyl)-1-cycloheptyl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(C2CCCCCC2)C(=O)C1/C=N/Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H23N3O5/c24-18-15(11-21-10-13-7-8-16-17(9-13)28-12-27-16)19(25)23(20(26)22-18)14-5-3-1-2-4-6-14/h7-9,11,14-15H,1-6,10,12H2,(H,22,24,26)/b21-11+ |
| InChIKey | XANOYNQRTBJOKS-SRZZPIQSSA-N |
| XLogP | 2.40 |
| TPSA | 97.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|