C13H12N3O4S+ — CID 6955998
1,3-benzodioxol-5-ylmethyl-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylidene]azanium (PubChem CID 6955998) has the molecular formula C13H12N3O4S+ and a molecular weight of 306.32 g/mol. Its IUPAC name is 1,3-benzodioxol-5-ylmethyl-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylidene]azanium.
| Compound Name | 1,3-benzodioxol-5-ylmethyl-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylidene]azanium |
|---|---|
| PubChem CID | 6955998 |
| Molecular Formula | C13H12N3O4S+ |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 1,3-benzodioxol-5-ylmethyl-[(4,6-dioxo-2-sulfanylidene-1,3-diazinan-5-yl)methylidene]azanium |
| SMILES | O=C1NC(=S)NC(=O)C1/C=[NH+]/Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C13H11N3O4S/c17-11-8(12(18)16-13(21)15-11)5-14-4-7-1-2-9-10(3-7)20-6-19-9/h1-3,5,8H,4,6H2,(H2,15,16,17,18,21)/p+1/b14-5+ |
| InChIKey | ORNBLVKGAVVBIT-LHHJGKSTSA-O |
| XLogP | -1.79 |
| TPSA | 90.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | -1.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|