C23H31N4O3+ — CID 7301613
5-[(1-benzylpiperidin-1-ium-4-yl)iminomethyl]-1-cyclohexyl-1,3-diazinane-2,4,6-trione (PubChem CID 7301613) has the molecular formula C23H31N4O3+ and a molecular weight of 411.53 g/mol. Its IUPAC name is 5-[(1-benzylpiperidin-1-ium-4-yl)iminomethyl]-1-cyclohexyl-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(1-benzylpiperidin-1-ium-4-yl)iminomethyl]-1-cyclohexyl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7301613 |
| Molecular Formula | C23H31N4O3+ |
| Molecular Weight | 411.53 g/mol |
| Exact Mass | 411.24 |
| IUPAC Name | 5-[(1-benzylpiperidin-1-ium-4-yl)iminomethyl]-1-cyclohexyl-1,3-diazinane-2,4,6-trione |
| SMILES | O=C1NC(=O)N(C2CCCCC2)C(=O)C1/C=N/C1CC[NH+](Cc2ccccc2)CC1 |
| InChI | InChI=1S/C23H30N4O3/c28-21-20(22(29)27(23(30)25-21)19-9-5-2-6-10-19)15-24-18-11-13-26(14-12-18)16-17-7-3-1-4-8-17/h1,3-4,7-8,15,18-20H,2,5-6,9-14,16H2,(H,25,28,30)/p+1/b24-15+ |
| InChIKey | COJRBRJRTWMGAZ-BUVRLJJBSA-O |
| XLogP | 1.33 |
| TPSA | 83.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.53 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|