C27H37NO2 — CID 167545184
benzylbenzene;1-cyclohexyl-3,4-dimethylpyrrolidine-2,5-dione;ethane (PubChem CID 167545184) has the molecular formula C27H37NO2 and a molecular weight of 407.60 g/mol. Its IUPAC name is benzylbenzene;1-cyclohexyl-3,4-dimethylpyrrolidine-2,5-dione;ethane.
| Compound Name | benzylbenzene;1-cyclohexyl-3,4-dimethylpyrrolidine-2,5-dione;ethane |
|---|---|
| PubChem CID | 167545184 |
| Molecular Formula | C27H37NO2 |
| Molecular Weight | 407.60 g/mol |
| Exact Mass | 407.28 |
| IUPAC Name | benzylbenzene;1-cyclohexyl-3,4-dimethylpyrrolidine-2,5-dione;ethane |
| SMILES | CC.CC1C(=O)N(C2CCCCC2)C(=O)C1C.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.C12H19NO2.C2H6/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;1-8-9(2)12(15)13(11(8)14)10-6-4-3-5-7-10;1-2/h1-10H,11H2;8-10H,3-7H2,1-2H3;1-2H3 |
| InChIKey | BRUXPKATHNTNOV-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.60 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|