C21H19N3O6 — CID 7474403
(5R)-5-(1,3-benzodioxol-5-ylmethyliminomethyl)-1-(2-ethoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7474403) has the molecular formula C21H19N3O6 and a molecular weight of 409.40 g/mol. Its IUPAC name is (5R)-5-(1,3-benzodioxol-5-ylmethyliminomethyl)-1-(2-ethoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-5-(1,3-benzodioxol-5-ylmethyliminomethyl)-1-(2-ethoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7474403 |
| Molecular Formula | C21H19N3O6 |
| Molecular Weight | 409.40 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | (5R)-5-(1,3-benzodioxol-5-ylmethyliminomethyl)-1-(2-ethoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1ccccc1N1C(=O)NC(=O)[C@@H](/C=N/Cc2ccc3c(c2)OCO3)C1=O |
| InChI | InChI=1S/C21H19N3O6/c1-2-28-16-6-4-3-5-15(16)24-20(26)14(19(25)23-21(24)27)11-22-10-13-7-8-17-18(9-13)30-12-29-17/h3-9,11,14H,2,10,12H2,1H3,(H,23,25,27)/b22-11+/t14-/m1/s1 |
| InChIKey | VIWXINYWSKLGIU-DACUGSJHSA-N |
| XLogP | 2.28 |
| TPSA | 106.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.40 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|