C19H24N4O4 — CID 7474547
(5R)-5-[[(1S,2S)-2-aminocyclohexyl]iminomethyl]-1-(2-ethoxyphenyl)-1,3-diazinane-2,4,6-trione (PubChem CID 7474547) has the molecular formula C19H24N4O4 and a molecular weight of 372.43 g/mol. Its IUPAC name is (5R)-5-[[(1S,2S)-2-aminocyclohexyl]iminomethyl]-1-(2-ethoxyphenyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | (5R)-5-[[(1S,2S)-2-aminocyclohexyl]iminomethyl]-1-(2-ethoxyphenyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 7474547 |
| Molecular Formula | C19H24N4O4 |
| Molecular Weight | 372.43 g/mol |
| Exact Mass | 372.18 |
| IUPAC Name | (5R)-5-[[(1S,2S)-2-aminocyclohexyl]iminomethyl]-1-(2-ethoxyphenyl)-1,3-diazinane-2,4,6-trione |
| SMILES | CCOc1ccccc1N1C(=O)NC(=O)[C@@H](/C=N/[C@H]2CCCC[C@@H]2N)C1=O |
| InChI | InChI=1S/C19H24N4O4/c1-2-27-16-10-6-5-9-15(16)23-18(25)12(17(24)22-19(23)26)11-21-14-8-4-3-7-13(14)20/h5-6,9-14H,2-4,7-8,20H2,1H3,(H,22,24,26)/b21-11+/t12-,13+,14+/m1/s1 |
| InChIKey | UFERNFUCCSCJTH-PNBGGXMFSA-N |
| XLogP | 1.62 |
| TPSA | 114.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.43 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|