C20H20N2O4 — CID 18144813
2-[2-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]ethyl]isoindole-1,3-dione (PubChem CID 18144813) has the molecular formula C20H20N2O4 and a molecular weight of 352.39 g/mol. Its IUPAC name is 2-[2-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 18144813 |
| Molecular Formula | C20H20N2O4 |
| Molecular Weight | 352.39 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-[2-[1,3-benzodioxol-5-ylmethyl(ethyl)amino]ethyl]isoindole-1,3-dione |
| SMILES | CCN(CCN1C(=O)c2ccccc2C1=O)Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H20N2O4/c1-2-21(12-14-7-8-17-18(11-14)26-13-25-17)9-10-22-19(23)15-5-3-4-6-16(15)20(22)24/h3-8,11H,2,9-10,12-13H2,1H3 |
| InChIKey | XHSBZSJYRJYEOO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|