C13H13F4NO3 — CID 103732398
N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2,2,3,3-tetrafluoropropanamide (PubChem CID 103732398) has the molecular formula C13H13F4NO3 and a molecular weight of 307.24 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103732398 |
| Molecular Formula | C13H13F4NO3 |
| Molecular Weight | 307.24 g/mol |
| Exact Mass | 307.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-N-ethyl-2,2,3,3-tetrafluoropropanamide |
| SMILES | CCN(Cc1ccc2c(c1)OCO2)C(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C13H13F4NO3/c1-2-18(12(19)13(16,17)11(14)15)6-8-3-4-9-10(5-8)21-7-20-9/h3-5,11H,2,6-7H2,1H3 |
| InChIKey | MWYSLPYXTYYNHS-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.24 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|