C14H14F5NO3 — CID 91719502
N-[2-(1,3-benzodioxol-5-yl)ethyl]-N-ethyl-2,2,3,3,3-pentafluoropropanamide (PubChem CID 91719502) has the molecular formula C14H14F5NO3 and a molecular weight of 339.26 g/mol. Its IUPAC name is N-[2-(1,3-benzodioxol-5-yl)ethyl]-N-ethyl-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-N-ethyl-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 91719502 |
| Molecular Formula | C14H14F5NO3 |
| Molecular Weight | 339.26 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | N-[2-(1,3-benzodioxol-5-yl)ethyl]-N-ethyl-2,2,3,3,3-pentafluoropropanamide |
| SMILES | CCN(CCc1ccc2c(c1)OCO2)C(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C14H14F5NO3/c1-2-20(12(21)13(15,16)14(17,18)19)6-5-9-3-4-10-11(7-9)23-8-22-10/h3-4,7H,2,5-6,8H2,1H3 |
| InChIKey | BXARNWIDHRORHR-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.26 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|